C17H18BrNO4 — CID 26663841
(E)-3-(5-bromofuran-2-yl)-N-(2,5-diethoxyphenyl)prop-2-enamide (PubChem CID 26663841) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-N-(2,5-diethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-N-(2,5-diethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26663841 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-N-(2,5-diethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)/C=C/c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C17H18BrNO4/c1-3-21-13-5-8-15(22-4-2)14(11-13)19-17(20)10-7-12-6-9-16(18)23-12/h5-11H,3-4H2,1-2H3,(H,19,20)/b10-7+ |
| InChIKey | BVPHELUCYJFOSY-JXMROGBWSA-N |
| XLogP | 4.49 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|