C15H16BrNO4 — CID 26180023
5-bromo-N-(2,5-diethoxyphenyl)furan-2-carboxamide (PubChem CID 26180023) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 5-bromo-N-(2,5-diethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(2,5-diethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 26180023 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 5-bromo-N-(2,5-diethoxyphenyl)furan-2-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C15H16BrNO4/c1-3-19-10-5-6-12(20-4-2)11(9-10)17-15(18)13-7-8-14(16)21-13/h5-9H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | VBPZUYOYIGJJBG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |