C21H25N3O5 — CID 9490111
3,5-diacetamido-N-(2,5-diethoxyphenyl)benzamide (PubChem CID 9490111) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3,5-diacetamido-N-(2,5-diethoxyphenyl)benzamide.
| Compound Name | 3,5-diacetamido-N-(2,5-diethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 9490111 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 3,5-diacetamido-N-(2,5-diethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)c2cc(NC(C)=O)cc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C21H25N3O5/c1-5-28-18-7-8-20(29-6-2)19(12-18)24-21(27)15-9-16(22-13(3)25)11-17(10-15)23-14(4)26/h7-12H,5-6H2,1-4H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | ZAZBXCHWKMZFCB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |