C18H20N2O7S — CID 47847842
N-(2,5-diethoxyphenyl)-3-methylsulfonyl-5-nitrobenzamide (PubChem CID 47847842) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-3-methylsulfonyl-5-nitrobenzamide.
| Compound Name | N-(2,5-diethoxyphenyl)-3-methylsulfonyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 47847842 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-3-methylsulfonyl-5-nitrobenzamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)c2cc([N+](=O)[O-])cc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C18H20N2O7S/c1-4-26-14-6-7-17(27-5-2)16(11-14)19-18(21)12-8-13(20(22)23)10-15(9-12)28(3,24)25/h6-11H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | GBCBJYMJRLIFLU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|