C21H24N4O9S — CID 3411486
N-[2-(2-methoxyethoxy)-5-piperidin-1-ylsulfonylphenyl]-3,5-dinitrobenzamide (PubChem CID 3411486) has the molecular formula C21H24N4O9S and a molecular weight of 508.51 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-piperidin-1-ylsulfonylphenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-piperidin-1-ylsulfonylphenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3411486 |
| Molecular Formula | C21H24N4O9S |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-piperidin-1-ylsulfonylphenyl]-3,5-dinitrobenzamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N4O9S/c1-33-9-10-34-20-6-5-18(35(31,32)23-7-3-2-4-8-23)14-19(20)22-21(26)15-11-16(24(27)28)13-17(12-15)25(29)30/h5-6,11-14H,2-4,7-10H2,1H3,(H,22,26) |
| InChIKey | RDILEFJDELMYSK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|