C19H21N3O6S — CID 1300430
N-(2-methoxy-4-piperidin-1-ylsulfonylphenyl)-3-nitrobenzamide (PubChem CID 1300430) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is N-(2-methoxy-4-piperidin-1-ylsulfonylphenyl)-3-nitrobenzamide.
| Compound Name | N-(2-methoxy-4-piperidin-1-ylsulfonylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 1300430 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(2-methoxy-4-piperidin-1-ylsulfonylphenyl)-3-nitrobenzamide |
| SMILES | COc1cc(S(=O)(=O)N2CCCCC2)ccc1NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21N3O6S/c1-28-18-13-16(29(26,27)21-10-3-2-4-11-21)8-9-17(18)20-19(23)14-6-5-7-15(12-14)22(24)25/h5-9,12-13H,2-4,10-11H2,1H3,(H,20,23) |
| InChIKey | BFSRWSBNGWMJFE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|