C16H13BrN2O3S — CID 2123806
(E)-3-(5-bromofuran-2-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 2123806) has the molecular formula C16H13BrN2O3S and a molecular weight of 393.26 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2123806 |
| Molecular Formula | C16H13BrN2O3S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1ccc2nc(NC(=O)/C=C/c3ccc(Br)o3)sc2c1 |
| InChI | InChI=1S/C16H13BrN2O3S/c1-2-21-11-3-6-12-13(9-11)23-16(18-12)19-15(20)8-5-10-4-7-14(17)22-10/h3-9H,2H2,1H3,(H,18,19,20)/b8-5+ |
| InChIKey | XFDRTMQQXCZMTI-VMPITWQZSA-N |
| XLogP | 4.70 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|