C21H23F2NO5 — CID 26179996
(E)-N-(2,5-diethoxyphenyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 26179996) has the molecular formula C21H23F2NO5 and a molecular weight of 407.41 g/mol. Its IUPAC name is (E)-N-(2,5-diethoxyphenyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-(2,5-diethoxyphenyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26179996 |
| Molecular Formula | C21H23F2NO5 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (E)-N-(2,5-diethoxyphenyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)/C=C/c2ccc(OC(F)F)c(OC)c2)c1 |
| InChI | InChI=1S/C21H23F2NO5/c1-4-27-15-8-10-17(28-5-2)16(13-15)24-20(25)11-7-14-6-9-18(29-21(22)23)19(12-14)26-3/h6-13,21H,4-5H2,1-3H3,(H,24,25)/b11-7+ |
| InChIKey | IKMFMSPHSNLONE-YRNVUSSQSA-N |
| XLogP | 4.75 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|