C13H14F2O4 — CID 71628157
methyl (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoate (PubChem CID 71628157) has the molecular formula C13H14F2O4 and a molecular weight of 272.25 g/mol. Its IUPAC name is methyl (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 71628157 |
| Molecular Formula | C13H14F2O4 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | methyl (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OC)ccc1OC(F)F |
| InChI | InChI=1S/C13H14F2O4/c1-3-18-11-8-9(5-7-12(16)17-2)4-6-10(11)19-13(14)15/h4-8,13H,3H2,1-2H3/b7-5+ |
| InChIKey | GZBKYQYYIBQEKY-FNORWQNLSA-N |
| XLogP | 2.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|