C16H28ClN3O5S — CID 120984551
2-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide;hydrochloride (PubChem CID 120984551) has the molecular formula C16H28ClN3O5S and a molecular weight of 409.94 g/mol. Its IUPAC name is 2-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide;hydrochloride.
| Compound Name | 2-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 120984551 |
| Molecular Formula | C16H28ClN3O5S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-amino-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide;hydrochloride |
| SMILES | CCOc1ccc(NC(=O)C(N)COC)cc1S(=O)(=O)N(CC)CC.Cl |
| InChI | InChI=1S/C16H27N3O5S.ClH/c1-5-19(6-2)25(21,22)15-10-12(8-9-14(15)24-7-3)18-16(20)13(17)11-23-4;/h8-10,13H,5-7,11,17H2,1-4H3,(H,18,20);1H |
| InChIKey | NWXOMAXCBFPEEV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |