C16H27Cl2N3O3S — CID 119679919
(2S)-2-amino-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-methylpentanamide;hydrochloride (PubChem CID 119679919) has the molecular formula C16H27Cl2N3O3S and a molecular weight of 412.38 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119679919 |
| Molecular Formula | C16H27Cl2N3O3S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (2S)-2-amino-N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-methylpentanamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)[C@@H](N)CC(C)C)ccc1Cl.Cl |
| InChI | InChI=1S/C16H26ClN3O3S.ClH/c1-5-20(6-2)24(22,23)15-10-12(7-8-13(15)17)19-16(21)14(18)9-11(3)4;/h7-8,10-11,14H,5-6,9,18H2,1-4H3,(H,19,21);1H/t14-;/m0./s1 |
| InChIKey | RDMHRYWYSWWTDM-UQKRIMTDSA-N |
| XLogP | 3.10 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |