C17H29Cl2N3O3S — CID 119679881
7-amino-N-[4-chloro-3-(diethylsulfamoyl)phenyl]heptanamide;hydrochloride (PubChem CID 119679881) has the molecular formula C17H29Cl2N3O3S and a molecular weight of 426.41 g/mol. Its IUPAC name is 7-amino-N-[4-chloro-3-(diethylsulfamoyl)phenyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[4-chloro-3-(diethylsulfamoyl)phenyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119679881 |
| Molecular Formula | C17H29Cl2N3O3S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 7-amino-N-[4-chloro-3-(diethylsulfamoyl)phenyl]heptanamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CCCCCCN)ccc1Cl.Cl |
| InChI | InChI=1S/C17H28ClN3O3S.ClH/c1-3-21(4-2)25(23,24)16-13-14(10-11-15(16)18)20-17(22)9-7-5-6-8-12-19;/h10-11,13H,3-9,12,19H2,1-2H3,(H,20,22);1H |
| InChIKey | PSPAEJTVAOJRKO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|