C16H23ClN2O5S — CID 119133535
4-[4-chloro-3-(diethylsulfamoyl)anilino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 119133535) has the molecular formula C16H23ClN2O5S and a molecular weight of 390.89 g/mol. Its IUPAC name is 4-[4-chloro-3-(diethylsulfamoyl)anilino]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[4-chloro-3-(diethylsulfamoyl)anilino]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 119133535 |
| Molecular Formula | C16H23ClN2O5S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-[4-chloro-3-(diethylsulfamoyl)anilino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CC(C)(C)C(=O)O)ccc1Cl |
| InChI | InChI=1S/C16H23ClN2O5S/c1-5-19(6-2)25(23,24)13-9-11(7-8-12(13)17)18-14(20)10-16(3,4)15(21)22/h7-9H,5-6,10H2,1-4H3,(H,18,20)(H,21,22) |
| InChIKey | RKWNQWIDWVHTDV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |