C14H21ClN2O3S — CID 9451643
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3,3-dimethylbutanamide (PubChem CID 9451643) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 9451643 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)CC(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C14H21ClN2O3S/c1-14(2,3)9-13(18)16-10-6-7-11(15)12(8-10)21(19,20)17(4)5/h6-8H,9H2,1-5H3,(H,16,18) |
| InChIKey | YYGSOBAVJLSDPE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |