C23H22ClN3O3S2 — CID 3314091
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3-phenothiazin-10-ylpropanamide (PubChem CID 3314091) has the molecular formula C23H22ClN3O3S2 and a molecular weight of 488.03 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3-phenothiazin-10-ylpropanamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3-phenothiazin-10-ylpropanamide |
|---|---|
| PubChem CID | 3314091 |
| Molecular Formula | C23H22ClN3O3S2 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3-phenothiazin-10-ylpropanamide |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)CCN2c3ccccc3Sc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C23H22ClN3O3S2/c1-26(2)32(29,30)22-15-16(11-12-17(22)24)25-23(28)13-14-27-18-7-3-5-9-20(18)31-21-10-6-4-8-19(21)27/h3-12,15H,13-14H2,1-2H3,(H,25,28) |
| InChIKey | YBGHQCCZNMZERM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|