C12H14ClN5O3S — CID 100680707
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3-methyltriazole-4-carboxamide (PubChem CID 100680707) has the molecular formula C12H14ClN5O3S and a molecular weight of 343.80 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3-methyltriazole-4-carboxamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 100680707 |
| Molecular Formula | C12H14ClN5O3S |
| Molecular Weight | 343.80 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-3-methyltriazole-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)c2cnnn2C)ccc1Cl |
| InChI | InChI=1S/C12H14ClN5O3S/c1-17(2)22(20,21)11-6-8(4-5-9(11)13)15-12(19)10-7-14-16-18(10)3/h4-7H,1-3H3,(H,15,19) |
| InChIKey | FZLMCHDDAUEVMZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.80 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |