C13H17ClN6O3S2 — CID 43014157
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 43014157) has the molecular formula C13H17ClN6O3S2 and a molecular weight of 404.91 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 43014157 |
| Molecular Formula | C13H17ClN6O3S2 |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(1-methyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1C)C(=O)Nc1ccc(Cl)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H17ClN6O3S2/c1-8(24-13-16-17-18-20(13)4)12(21)15-9-5-6-10(14)11(7-9)25(22,23)19(2)3/h5-8H,1-4H3,(H,15,21) |
| InChIKey | FMPSGBYNADNZCK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |