C12H12F3N5OS — CID 16525334
2-(1-methyltetrazol-5-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 16525334) has the molecular formula C12H12F3N5OS and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 16525334 |
| Molecular Formula | C12H12F3N5OS |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Sc1nnnn1C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3N5OS/c1-7(22-11-17-18-19-20(11)2)10(21)16-9-5-3-4-8(6-9)12(13,14)15/h3-7H,1-2H3,(H,16,21) |
| InChIKey | WZAOJYGKDINEQS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |