C18H16F3N5O2S — CID 16536151
2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 16536151) has the molecular formula C18H16F3N5O2S and a molecular weight of 423.42 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 16536151 |
| Molecular Formula | C18H16F3N5O2S |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | COc1ccccc1-n1nnnc1SC(C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3N5O2S/c1-11(16(27)22-13-7-5-6-12(10-13)18(19,20)21)29-17-23-24-25-26(17)14-8-3-4-9-15(14)28-2/h3-11H,1-2H3,(H,22,27) |
| InChIKey | KFSJVDWJVRVKJE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |