C19H20FN5O2S — CID 8693395
(2S)-N-[2-(4-fluorophenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 8693395) has the molecular formula C19H20FN5O2S and a molecular weight of 401.47 g/mol. Its IUPAC name is (2S)-N-[2-(4-fluorophenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-[2-(4-fluorophenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 8693395 |
| Molecular Formula | C19H20FN5O2S |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (2S)-N-[2-(4-fluorophenyl)ethyl]-2-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | COc1ccccc1-n1nnnc1S[C@@H](C)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN5O2S/c1-13(18(26)21-12-11-14-7-9-15(20)10-8-14)28-19-22-23-24-25(19)16-5-3-4-6-17(16)27-2/h3-10,13H,11-12H2,1-2H3,(H,21,26)/t13-/m0/s1 |
| InChIKey | XBDFTXOUJCXBRR-ZDUSSCGKSA-N |
| XLogP | 2.65 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |