C18H19ClN4O3S2 — CID 4883079
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(2-methylsulfanylbenzimidazol-1-yl)acetamide (PubChem CID 4883079) has the molecular formula C18H19ClN4O3S2 and a molecular weight of 438.96 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(2-methylsulfanylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(2-methylsulfanylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 4883079 |
| Molecular Formula | C18H19ClN4O3S2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(2-methylsulfanylbenzimidazol-1-yl)acetamide |
| SMILES | CSc1nc2ccccc2n1CC(=O)Nc1ccc(Cl)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H19ClN4O3S2/c1-22(2)28(25,26)16-10-12(8-9-13(16)19)20-17(24)11-23-15-7-5-4-6-14(15)21-18(23)27-3/h4-10H,11H2,1-3H3,(H,20,24) |
| InChIKey | REIKALVQBPKPSU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |