C18H17F3N4O3S — CID 26196060
N-[4-(dimethylsulfamoyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 26196060) has the molecular formula C18H17F3N4O3S and a molecular weight of 426.42 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 26196060 |
| Molecular Formula | C18H17F3N4O3S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)Cn2c(C(F)(F)F)nc3ccccc32)cc1 |
| InChI | InChI=1S/C18H17F3N4O3S/c1-24(2)29(27,28)13-9-7-12(8-10-13)22-16(26)11-25-15-6-4-3-5-14(15)23-17(25)18(19,20)21/h3-10H,11H2,1-2H3,(H,22,26) |
| InChIKey | ICBHMGNPNUPIGK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |