C19H13F3N4O3 — CID 37003501
N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 37003501) has the molecular formula C19H13F3N4O3 and a molecular weight of 402.33 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 37003501 |
| Molecular Formula | C19H13F3N4O3 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)Cn3c(C(F)(F)F)nc4ccccc43)cc2C1=O |
| InChI | InChI=1S/C19H13F3N4O3/c1-25-16(28)11-7-6-10(8-12(11)17(25)29)23-15(27)9-26-14-5-3-2-4-13(14)24-18(26)19(20,21)22/h2-8H,9H2,1H3,(H,23,27) |
| InChIKey | YQHPACNXIXAXHQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|