C17H13F4N3O — CID 40723406
N-(2-fluoro-5-methylphenyl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 40723406) has the molecular formula C17H13F4N3O and a molecular weight of 351.30 g/mol. Its IUPAC name is N-(2-fluoro-5-methylphenyl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(2-fluoro-5-methylphenyl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 40723406 |
| Molecular Formula | C17H13F4N3O |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(2-fluoro-5-methylphenyl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | Cc1ccc(F)c(NC(=O)Cn2c(C(F)(F)F)nc3ccccc32)c1 |
| InChI | InChI=1S/C17H13F4N3O/c1-10-6-7-11(18)13(8-10)22-15(25)9-24-14-5-3-2-4-12(14)23-16(24)17(19,20)21/h2-8H,9H2,1H3,(H,22,25) |
| InChIKey | RPHYVDJSGBQYAP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |