C24H14F3N3O3 — CID 39045058
N-(9,10-dioxoanthracen-1-yl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 39045058) has the molecular formula C24H14F3N3O3 and a molecular weight of 449.39 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 39045058 |
| Molecular Formula | C24H14F3N3O3 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H14F3N3O3/c25-24(26,27)23-29-16-9-3-4-11-18(16)30(23)12-19(31)28-17-10-5-8-15-20(17)22(33)14-7-2-1-6-13(14)21(15)32/h1-11H,12H2,(H,28,31) |
| InChIKey | ZBKKENWHUKPDAM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|