C21H21F3N4O3S — CID 60549313
N-(2-piperidin-1-ylsulfonylphenyl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 60549313) has the molecular formula C21H21F3N4O3S and a molecular weight of 466.49 g/mol. Its IUPAC name is N-(2-piperidin-1-ylsulfonylphenyl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-(2-piperidin-1-ylsulfonylphenyl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 60549313 |
| Molecular Formula | C21H21F3N4O3S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N-(2-piperidin-1-ylsulfonylphenyl)-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)Nc1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H21F3N4O3S/c22-21(23,24)20-26-15-8-2-4-10-17(15)28(20)14-19(29)25-16-9-3-5-11-18(16)32(30,31)27-12-6-1-7-13-27/h2-5,8-11H,1,6-7,12-14H2,(H,25,29) |
| InChIKey | JUJNWBCDHCHMDR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |