C14H14F3N3O — CID 1477753
1-pyrrolidin-1-yl-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanone (PubChem CID 1477753) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanone.
| Compound Name | 1-pyrrolidin-1-yl-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 1477753 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-pyrrolidin-1-yl-2-[2-(trifluoromethyl)benzimidazol-1-yl]ethanone |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)N1CCCC1 |
| InChI | InChI=1S/C14H14F3N3O/c15-14(16,17)13-18-10-5-1-2-6-11(10)20(13)9-12(21)19-7-3-4-8-19/h1-2,5-6H,3-4,7-9H2 |
| InChIKey | VIJJXTRIWHUMMR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |