C22H21F3N4O2 — CID 35275235
N-[2-(piperidine-1-carbonyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 35275235) has the molecular formula C22H21F3N4O2 and a molecular weight of 430.43 g/mol. Its IUPAC name is N-[2-(piperidine-1-carbonyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-[2-(piperidine-1-carbonyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 35275235 |
| Molecular Formula | C22H21F3N4O2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[2-(piperidine-1-carbonyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)Nc1ccccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H21F3N4O2/c23-22(24,25)21-27-17-10-4-5-11-18(17)29(21)14-19(30)26-16-9-3-2-8-15(16)20(31)28-12-6-1-7-13-28/h2-5,8-11H,1,6-7,12-14H2,(H,26,30) |
| InChIKey | XWCBSVMPJPOWCX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |