C17H12F5N3OS — CID 40723417
N-[2-(difluoromethylsulfanyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 40723417) has the molecular formula C17H12F5N3OS and a molecular weight of 401.36 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 40723417 |
| Molecular Formula | C17H12F5N3OS |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C17H12F5N3OS/c18-16(19)27-13-8-4-2-6-11(13)23-14(26)9-25-12-7-3-1-5-10(12)24-15(25)17(20,21)22/h1-8,16H,9H2,(H,23,26) |
| InChIKey | WPOAPGWOVJHRIU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |