C25H21F3N4O2 — CID 30279791
N-(2-phenylethyl)-2-[[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]amino]benzamide (PubChem CID 30279791) has the molecular formula C25H21F3N4O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-[[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]amino]benzamide.
| Compound Name | N-(2-phenylethyl)-2-[[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 30279791 |
| Molecular Formula | C25H21F3N4O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-(2-phenylethyl)-2-[[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]amino]benzamide |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C25H21F3N4O2/c26-25(27,28)24-31-20-12-6-7-13-21(20)32(24)16-22(33)30-19-11-5-4-10-18(19)23(34)29-15-14-17-8-2-1-3-9-17/h1-13H,14-16H2,(H,29,34)(H,30,33) |
| InChIKey | OTUZVRFMMNBAOD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |