C14H16F3N3O — CID 977171
N,N-diethyl-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 977171) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N,N-diethyl-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 977171 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N,N-diethyl-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | CCN(CC)C(=O)Cn1c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C14H16F3N3O/c1-3-19(4-2)12(21)9-20-11-8-6-5-7-10(11)18-13(20)14(15,16)17/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | ZETIYUWKWRMRCV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |