C15H17F3N4O2 — CID 9417778
3-methyl-N'-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]butanehydrazide (PubChem CID 9417778) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 3-methyl-N'-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]butanehydrazide.
| Compound Name | 3-methyl-N'-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]butanehydrazide |
|---|---|
| PubChem CID | 9417778 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-methyl-N'-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]butanehydrazide |
| SMILES | CC(C)CC(=O)NNC(=O)Cn1c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C15H17F3N4O2/c1-9(2)7-12(23)20-21-13(24)8-22-11-6-4-3-5-10(11)19-14(22)15(16,17)18/h3-6,9H,7-8H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | CRTBYKYQQRNZBR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|