C18H15F3N4O2S — CID 9417771
(E)-3-(3-methylthiophen-2-yl)-N'-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]prop-2-enehydrazide (PubChem CID 9417771) has the molecular formula C18H15F3N4O2S and a molecular weight of 408.41 g/mol. Its IUPAC name is (E)-3-(3-methylthiophen-2-yl)-N'-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(3-methylthiophen-2-yl)-N'-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9417771 |
| Molecular Formula | C18H15F3N4O2S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (E)-3-(3-methylthiophen-2-yl)-N'-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]prop-2-enehydrazide |
| SMILES | Cc1ccsc1/C=C/C(=O)NNC(=O)Cn1c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C18H15F3N4O2S/c1-11-8-9-28-14(11)6-7-15(26)23-24-16(27)10-25-13-5-3-2-4-12(13)22-17(25)18(19,20)21/h2-9H,10H2,1H3,(H,23,26)(H,24,27)/b7-6+ |
| InChIKey | ZMVZDTJCTYWSLT-VOTSOKGWSA-N |
| XLogP | 3.29 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|