C17H13F3N6OS — CID 8812406
N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide (PubChem CID 8812406) has the molecular formula C17H13F3N6OS and a molecular weight of 406.39 g/mol. Its IUPAC name is N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide.
| Compound Name | N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 8812406 |
| Molecular Formula | C17H13F3N6OS |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetohydrazide |
| SMILES | Cc1csc(/C(C#N)=C/NNC(=O)Cn2c(C(F)(F)F)nc3ccccc32)n1 |
| InChI | InChI=1S/C17H13F3N6OS/c1-10-9-28-15(23-10)11(6-21)7-22-25-14(27)8-26-13-5-3-2-4-12(13)24-16(26)17(18,19)20/h2-5,7,9,22H,8H2,1H3,(H,25,27)/b11-7+ |
| InChIKey | GCYROMMJCQIMGY-YRNVUSSQSA-N |
| XLogP | 3.01 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|