C17H18N4O2S — CID 8811709
N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-(3,4-dimethylphenoxy)acetohydrazide (PubChem CID 8811709) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-(3,4-dimethylphenoxy)acetohydrazide.
| Compound Name | N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-(3,4-dimethylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 8811709 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N'-[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]-2-(3,4-dimethylphenoxy)acetohydrazide |
| SMILES | Cc1csc(/C(C#N)=C/NNC(=O)COc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C17H18N4O2S/c1-11-4-5-15(6-12(11)2)23-9-16(22)21-19-8-14(7-18)17-20-13(3)10-24-17/h4-6,8,10,19H,9H2,1-3H3,(H,21,22)/b14-8+ |
| InChIKey | OKPKTBKJXIRRGQ-RIYZIHGNSA-N |
| XLogP | 2.63 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|