C13H11N3S — CID 8811112
(E)-3-anilino-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811112) has the molecular formula C13H11N3S and a molecular weight of 241.32 g/mol. Its IUPAC name is (E)-3-anilino-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-anilino-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811112 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (E)-3-anilino-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccccc2)n1 |
| InChI | InChI=1S/C13H11N3S/c1-10-9-17-13(16-10)11(7-14)8-15-12-5-3-2-4-6-12/h2-6,8-9,15H,1H3/b11-8+ |
| InChIKey | JXPJPSLOKRMCDP-DHZHZOJOSA-N |
| XLogP | 3.43 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|