C21H15ClN4S — CID 8811951
(E)-3-[3-chloro-4-[(R)-cyano(phenyl)methyl]anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811951) has the molecular formula C21H15ClN4S and a molecular weight of 390.90 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[(R)-cyano(phenyl)methyl]anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-chloro-4-[(R)-cyano(phenyl)methyl]anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811951 |
| Molecular Formula | C21H15ClN4S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (E)-3-[3-chloro-4-[(R)-cyano(phenyl)methyl]anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccc([C@H](C#N)c3ccccc3)c(Cl)c2)n1 |
| InChI | InChI=1S/C21H15ClN4S/c1-14-13-27-21(26-14)16(10-23)12-25-17-7-8-18(20(22)9-17)19(11-24)15-5-3-2-4-6-15/h2-9,12-13,19,25H,1H3/b16-12+/t19-/m1/s1 |
| InChIKey | FRYNKBMYGMPTRE-APEZIOSESA-N |
| XLogP | 5.74 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|