C15H14ClN3O2S — CID 8812524
(E)-3-(4-chloro-2,5-dimethoxyanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8812524) has the molecular formula C15H14ClN3O2S and a molecular weight of 335.82 g/mol. Its IUPAC name is (E)-3-(4-chloro-2,5-dimethoxyanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-chloro-2,5-dimethoxyanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8812524 |
| Molecular Formula | C15H14ClN3O2S |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | (E)-3-(4-chloro-2,5-dimethoxyanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1cc(N/C=C(\C#N)c2nc(C)cs2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H14ClN3O2S/c1-9-8-22-15(19-9)10(6-17)7-18-12-5-13(20-2)11(16)4-14(12)21-3/h4-5,7-8,18H,1-3H3/b10-7+ |
| InChIKey | FZKJRTKWVATVLL-JXMROGBWSA-N |
| XLogP | 4.10 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|