C13H12N4S — CID 8811344
(E)-3-[(6-methyl-2-pyridinyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811344) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is (E)-3-[(6-methyl-2-pyridinyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[(6-methyl-2-pyridinyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811344 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (E)-3-[(6-methyl-2-pyridinyl)amino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cccc(N/C=C(\C#N)c2nc(C)cs2)n1 |
| InChI | InChI=1S/C13H12N4S/c1-9-4-3-5-12(16-9)15-7-11(6-14)13-17-10(2)8-18-13/h3-5,7-8H,1-2H3,(H,15,16)/b11-7+ |
| InChIKey | PYBSNKIMSWWWBU-YRNVUSSQSA-N |
| XLogP | 3.13 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|