C18H12N4S2 — CID 8811749
(E)-3-(benzo[e][1,3]benzothiazol-2-ylamino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811749) has the molecular formula C18H12N4S2 and a molecular weight of 348.46 g/mol. Its IUPAC name is (E)-3-(benzo[e][1,3]benzothiazol-2-ylamino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(benzo[e][1,3]benzothiazol-2-ylamino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811749 |
| Molecular Formula | C18H12N4S2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (E)-3-(benzo[e][1,3]benzothiazol-2-ylamino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2nc3c(ccc4ccccc43)s2)n1 |
| InChI | InChI=1S/C18H12N4S2/c1-11-10-23-17(21-11)13(8-19)9-20-18-22-16-14-5-3-2-4-12(14)6-7-15(16)24-18/h2-7,9-10H,1H3,(H,20,22)/b13-9+ |
| InChIKey | OZQVHCXTEIMIPB-UKTHLTGXSA-N |
| XLogP | 5.19 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|