C15H15N3S — CID 8811777
(E)-3-(2-ethylanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811777) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (E)-3-(2-ethylanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2-ethylanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811777 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (E)-3-(2-ethylanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCc1ccccc1N/C=C(\C#N)c1nc(C)cs1 |
| InChI | InChI=1S/C15H15N3S/c1-3-12-6-4-5-7-14(12)17-9-13(8-16)15-18-11(2)10-19-15/h4-7,9-10,17H,3H2,1-2H3/b13-9+ |
| InChIKey | SVJRGIUZWXRZSL-UKTHLTGXSA-N |
| XLogP | 3.99 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|