C20H14N4S2 — CID 8812777
(E)-3-[2-(1,3-benzothiazol-2-yl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8812777) has the molecular formula C20H14N4S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is (E)-3-[2-(1,3-benzothiazol-2-yl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[2-(1,3-benzothiazol-2-yl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8812777 |
| Molecular Formula | C20H14N4S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (E)-3-[2-(1,3-benzothiazol-2-yl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccccc2-c2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C20H14N4S2/c1-13-12-25-19(23-13)14(10-21)11-22-16-7-3-2-6-15(16)20-24-17-8-4-5-9-18(17)26-20/h2-9,11-12,22H,1H3/b14-11+ |
| InChIKey | VKCICVOYVITESQ-SDNWHVSQSA-N |
| XLogP | 5.70 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|