C21H16N4S2 — CID 8812078
(E)-3-[4-(1,3-benzothiazol-2-ylmethyl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8812078) has the molecular formula C21H16N4S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is (E)-3-[4-(1,3-benzothiazol-2-ylmethyl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-(1,3-benzothiazol-2-ylmethyl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8812078 |
| Molecular Formula | C21H16N4S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (E)-3-[4-(1,3-benzothiazol-2-ylmethyl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccc(Cc3nc4ccccc4s3)cc2)n1 |
| InChI | InChI=1S/C21H16N4S2/c1-14-13-26-21(24-14)16(11-22)12-23-17-8-6-15(7-9-17)10-20-25-18-4-2-3-5-19(18)27-20/h2-9,12-13,23H,10H2,1H3/b16-12+ |
| InChIKey | HXPYPWRAHAUYII-FOWTUZBSSA-N |
| XLogP | 5.63 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|