C14H11F2N3S2 — CID 8811053
(E)-3-[4-(difluoromethylsulfanyl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811053) has the molecular formula C14H11F2N3S2 and a molecular weight of 323.39 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethylsulfanyl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-(difluoromethylsulfanyl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811053 |
| Molecular Formula | C14H11F2N3S2 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | (E)-3-[4-(difluoromethylsulfanyl)anilino]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccc(SC(F)F)cc2)n1 |
| InChI | InChI=1S/C14H11F2N3S2/c1-9-8-20-13(19-9)10(6-17)7-18-11-2-4-12(5-3-11)21-14(15)16/h2-5,7-8,14,18H,1H3/b10-7+ |
| InChIKey | ZOXCSONPEZOHAB-JXMROGBWSA-N |
| XLogP | 4.74 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|