C13H10F2N4S — CID 8811175
(E)-3-[2-(2,4-difluorophenyl)hydrazinyl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811175) has the molecular formula C13H10F2N4S and a molecular weight of 292.31 g/mol. Its IUPAC name is (E)-3-[2-(2,4-difluorophenyl)hydrazinyl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[2-(2,4-difluorophenyl)hydrazinyl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811175 |
| Molecular Formula | C13H10F2N4S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (E)-3-[2-(2,4-difluorophenyl)hydrazinyl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/NNc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C13H10F2N4S/c1-8-7-20-13(18-8)9(5-16)6-17-19-12-3-2-10(14)4-11(12)15/h2-4,6-7,17,19H,1H3/b9-6+ |
| InChIKey | XGMKIWCSLMNPLK-RMKNXTFCSA-N |
| XLogP | 3.21 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|