C12H10N4S — CID 8821609
(E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(pyridin-4-ylamino)prop-2-enenitrile (PubChem CID 8821609) has the molecular formula C12H10N4S and a molecular weight of 242.31 g/mol. Its IUPAC name is (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(pyridin-4-ylamino)prop-2-enenitrile.
| Compound Name | (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(pyridin-4-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 8821609 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (E)-2-(4-methyl-1,3-thiazol-2-yl)-3-(pyridin-4-ylamino)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccncc2)n1 |
| InChI | InChI=1S/C12H10N4S/c1-9-8-17-12(16-9)10(6-13)7-15-11-2-4-14-5-3-11/h2-5,7-8H,1H3,(H,14,15)/b10-7+ |
| InChIKey | YRBYJZUOCQHCER-JXMROGBWSA-N |
| XLogP | 2.82 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|