C13H10BrN3S — CID 8811115
(E)-3-(4-bromoanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811115) has the molecular formula C13H10BrN3S and a molecular weight of 320.22 g/mol. Its IUPAC name is (E)-3-(4-bromoanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-bromoanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811115 |
| Molecular Formula | C13H10BrN3S |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | (E)-3-(4-bromoanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C13H10BrN3S/c1-9-8-18-13(17-9)10(6-15)7-16-12-4-2-11(14)3-5-12/h2-5,7-8,16H,1H3/b10-7+ |
| InChIKey | VLWQMAXPUCUYFB-JXMROGBWSA-N |
| XLogP | 4.19 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|