C13H9Cl2N3S — CID 8811145
(E)-3-(3,4-dichloroanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 8811145) has the molecular formula C13H9Cl2N3S and a molecular weight of 310.21 g/mol. Its IUPAC name is (E)-3-(3,4-dichloroanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,4-dichloroanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8811145 |
| Molecular Formula | C13H9Cl2N3S |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | (E)-3-(3,4-dichloroanilino)-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H9Cl2N3S/c1-8-7-19-13(18-8)9(5-16)6-17-10-2-3-11(14)12(15)4-10/h2-4,6-7,17H,1H3/b9-6+ |
| InChIKey | HQOWPQSJCXEOBN-RMKNXTFCSA-N |
| XLogP | 4.73 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|