C17H15N5O3S2 — CID 8811379
4-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 8811379) has the molecular formula C17H15N5O3S2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 8811379 |
| Molecular Formula | C17H15N5O3S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 4-[[(E)-2-cyano-2-(4-methyl-1,3-thiazol-2-yl)ethenyl]amino]-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Cc1csc(/C(C#N)=C/Nc2ccc(S(=O)(=O)Nc3cc(C)on3)cc2)n1 |
| InChI | InChI=1S/C17H15N5O3S2/c1-11-10-26-17(20-11)13(8-18)9-19-14-3-5-15(6-4-14)27(23,24)22-16-7-12(2)25-21-16/h3-7,9-10,19H,1-2H3,(H,21,22)/b13-9+ |
| InChIKey | MJMOMDWCBYEXLQ-UKTHLTGXSA-N |
| XLogP | 3.53 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|