C20H18N4O2S2 — CID 5215982
4-[[2-cyano-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzenesulfonamide (PubChem CID 5215982) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[[2-cyano-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzenesulfonamide.
| Compound Name | 4-[[2-cyano-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 5215982 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 4-[[2-cyano-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzenesulfonamide |
| SMILES | Cc1ccc(-c2csc(C(C#N)=CNc3ccc(S(N)(=O)=O)cc3)n2)cc1C |
| InChI | InChI=1S/C20H18N4O2S2/c1-13-3-4-15(9-14(13)2)19-12-27-20(24-19)16(10-21)11-23-17-5-7-18(8-6-17)28(22,25)26/h3-9,11-12,23H,1-2H3,(H2,22,25,26) |
| InChIKey | FAAYPYHOXKGVTM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|